C26H25Cl3N2O3 — CID 52994272
3-(4-chlorophenyl)-7-hydroxy-8-[[(2S)-2-pyridin-3-ylpiperidin-1-yl]methyl]chromen-4-one;dihydrochloride (PubChem CID 52994272) has the molecular formula C26H25Cl3N2O3 and a molecular weight of 519.86 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-7-hydroxy-8-[[(2S)-2-pyridin-3-ylpiperidin-1-yl]methyl]chromen-4-one;dihydrochloride.
| Compound Name | 3-(4-chlorophenyl)-7-hydroxy-8-[[(2S)-2-pyridin-3-ylpiperidin-1-yl]methyl]chromen-4-one;dihydrochloride |
|---|---|
| PubChem CID | 52994272 |
| Molecular Formula | C26H25Cl3N2O3 |
| Molecular Weight | 519.86 g/mol |
| Exact Mass | 518.09 |
| IUPAC Name | 3-(4-chlorophenyl)-7-hydroxy-8-[[(2S)-2-pyridin-3-ylpiperidin-1-yl]methyl]chromen-4-one;dihydrochloride |
| SMILES | Cl.Cl.O=c1c(-c2ccc(Cl)cc2)coc2c(CN3CCCC[C@H]3c3cccnc3)c(O)ccc12 |
| InChI | InChI=1S/C26H23ClN2O3.2ClH/c27-19-8-6-17(7-9-19)22-16-32-26-20(25(22)31)10-11-24(30)21(26)15-29-13-2-1-5-23(29)18-4-3-12-28-14-18;;/h3-4,6-12,14,16,23,30H,1-2,5,13,15H2;2*1H/t23-;;/m0../s1 |
| InChIKey | OMJZQECMPHMIKE-IFUPQEAVSA-N |
| XLogP | 6.78 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.86 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|