C22H24ClNO3 — CID 5451599
3-(4-chlorophenyl)-8-[(dipropylamino)methyl]-7-hydroxychromen-4-one (PubChem CID 5451599) has the molecular formula C22H24ClNO3 and a molecular weight of 385.89 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-8-[(dipropylamino)methyl]-7-hydroxychromen-4-one.
| Compound Name | 3-(4-chlorophenyl)-8-[(dipropylamino)methyl]-7-hydroxychromen-4-one |
|---|---|
| PubChem CID | 5451599 |
| Molecular Formula | C22H24ClNO3 |
| Molecular Weight | 385.89 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 3-(4-chlorophenyl)-8-[(dipropylamino)methyl]-7-hydroxychromen-4-one |
| SMILES | CCCN(CCC)Cc1c(O)ccc2c(=O)c(-c3ccc(Cl)cc3)coc12 |
| InChI | InChI=1S/C22H24ClNO3/c1-3-11-24(12-4-2)13-18-20(25)10-9-17-21(26)19(14-27-22(17)18)15-5-7-16(23)8-6-15/h5-10,14,25H,3-4,11-13H2,1-2H3 |
| InChIKey | HMIWWXWHZDVFBV-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.89 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|