C20H21BrNO3+ — CID 6984386
[3-(4-bromophenyl)-7-hydroxy-4-oxochromen-8-yl]methyl-diethylazanium (PubChem CID 6984386) has the molecular formula C20H21BrNO3+ and a molecular weight of 403.30 g/mol. Its IUPAC name is [3-(4-bromophenyl)-7-hydroxy-4-oxochromen-8-yl]methyl-diethylazanium.
| Compound Name | [3-(4-bromophenyl)-7-hydroxy-4-oxochromen-8-yl]methyl-diethylazanium |
|---|---|
| PubChem CID | 6984386 |
| Molecular Formula | C20H21BrNO3+ |
| Molecular Weight | 403.30 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | [3-(4-bromophenyl)-7-hydroxy-4-oxochromen-8-yl]methyl-diethylazanium |
| SMILES | CC[NH+](CC)Cc1c(O)ccc2c(=O)c(-c3ccc(Br)cc3)coc12 |
| InChI | InChI=1S/C20H20BrNO3/c1-3-22(4-2)11-16-18(23)10-9-15-19(24)17(12-25-20(15)16)13-5-7-14(21)8-6-13/h5-10,12,23H,3-4,11H2,1-2H3/p+1 |
| InChIKey | XRIGGVSAUXEEKO-UHFFFAOYSA-O |
| XLogP | 3.35 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|