C24H30ClNO7 — CID 126476262
8-[[bis(2-methylpropyl)amino]methyl]-7-hydroxy-3-phenylchromen-4-one;perchloric acid (PubChem CID 126476262) has the molecular formula C24H30ClNO7 and a molecular weight of 479.96 g/mol. Its IUPAC name is 8-[[bis(2-methylpropyl)amino]methyl]-7-hydroxy-3-phenylchromen-4-one;perchloric acid.
| Compound Name | 8-[[bis(2-methylpropyl)amino]methyl]-7-hydroxy-3-phenylchromen-4-one;perchloric acid |
|---|---|
| PubChem CID | 126476262 |
| Molecular Formula | C24H30ClNO7 |
| Molecular Weight | 479.96 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 8-[[bis(2-methylpropyl)amino]methyl]-7-hydroxy-3-phenylchromen-4-one;perchloric acid |
| SMILES | CC(C)CN(Cc1c(O)ccc2c(=O)c(-c3ccccc3)coc12)CC(C)C.[O-][Cl+3]([O-])([O-])O |
| InChI | InChI=1S/C24H29NO3.ClHO4/c1-16(2)12-25(13-17(3)4)14-20-22(26)11-10-19-23(27)21(15-28-24(19)20)18-8-6-5-7-9-18;2-1(3,4)5/h5-11,15-17,26H,12-14H2,1-4H3;(H,2,3,4,5) |
| InChIKey | XDSDFFHAXCBNSI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 143.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.96 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|