C22H28N2O2 — CID 136752928
7-[[bis(2-methylpropyl)amino]methyl]-3-phenyl-1,2-benzoxazol-6-ol (PubChem CID 136752928) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 7-[[bis(2-methylpropyl)amino]methyl]-3-phenyl-1,2-benzoxazol-6-ol.
| Compound Name | 7-[[bis(2-methylpropyl)amino]methyl]-3-phenyl-1,2-benzoxazol-6-ol |
|---|---|
| PubChem CID | 136752928 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 7-[[bis(2-methylpropyl)amino]methyl]-3-phenyl-1,2-benzoxazol-6-ol |
| SMILES | CC(C)CN(Cc1c(O)ccc2c(-c3ccccc3)noc12)CC(C)C |
| InChI | InChI=1S/C22H28N2O2/c1-15(2)12-24(13-16(3)4)14-19-20(25)11-10-18-21(23-26-22(18)19)17-8-6-5-7-9-17/h5-11,15-16,25H,12-14H2,1-4H3 |
| InChIKey | XRHSFTXNPZVUFJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|