C27H25ClN2O3 — CID 5451602
8-[(4-benzylpiperazin-1-yl)methyl]-3-(4-chlorophenyl)-7-hydroxychromen-4-one (PubChem CID 5451602) has the molecular formula C27H25ClN2O3 and a molecular weight of 460.96 g/mol. Its IUPAC name is 8-[(4-benzylpiperazin-1-yl)methyl]-3-(4-chlorophenyl)-7-hydroxychromen-4-one.
| Compound Name | 8-[(4-benzylpiperazin-1-yl)methyl]-3-(4-chlorophenyl)-7-hydroxychromen-4-one |
|---|---|
| PubChem CID | 5451602 |
| Molecular Formula | C27H25ClN2O3 |
| Molecular Weight | 460.96 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 8-[(4-benzylpiperazin-1-yl)methyl]-3-(4-chlorophenyl)-7-hydroxychromen-4-one |
| SMILES | O=c1c(-c2ccc(Cl)cc2)coc2c(CN3CCN(Cc4ccccc4)CC3)c(O)ccc12 |
| InChI | InChI=1S/C27H25ClN2O3/c28-21-8-6-20(7-9-21)24-18-33-27-22(26(24)32)10-11-25(31)23(27)17-30-14-12-29(13-15-30)16-19-4-2-1-3-5-19/h1-11,18,31H,12-17H2 |
| InChIKey | SIMYSFRVSLNZHC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.96 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|