C29H23BrN2O5 — CID 95399181
4-(6-bromo-2-oxochromen-3-yl)-7-hydroxy-8-[[(2S)-2-pyridin-3-ylpiperidin-1-yl]methyl]chromen-2-one (PubChem CID 95399181) has the molecular formula C29H23BrN2O5 and a molecular weight of 559.42 g/mol. Its IUPAC name is 4-(6-bromo-2-oxochromen-3-yl)-7-hydroxy-8-[[(2S)-2-pyridin-3-ylpiperidin-1-yl]methyl]chromen-2-one.
| Compound Name | 4-(6-bromo-2-oxochromen-3-yl)-7-hydroxy-8-[[(2S)-2-pyridin-3-ylpiperidin-1-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 95399181 |
| Molecular Formula | C29H23BrN2O5 |
| Molecular Weight | 559.42 g/mol |
| Exact Mass | 558.08 |
| IUPAC Name | 4-(6-bromo-2-oxochromen-3-yl)-7-hydroxy-8-[[(2S)-2-pyridin-3-ylpiperidin-1-yl]methyl]chromen-2-one |
| SMILES | O=c1cc(-c2cc3cc(Br)ccc3oc2=O)c2ccc(O)c(CN3CCCC[C@H]3c3cccnc3)c2o1 |
| InChI | InChI=1S/C29H23BrN2O5/c30-19-6-9-26-18(12-19)13-22(29(35)36-26)21-14-27(34)37-28-20(21)7-8-25(33)23(28)16-32-11-2-1-5-24(32)17-4-3-10-31-15-17/h3-4,6-10,12-15,24,33H,1-2,5,11,16H2/t24-/m0/s1 |
| InChIKey | MGRRNACLZBZFPY-DEOSSOPVSA-N |
| XLogP | 6.16 |
| TPSA | 96.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.42 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|