C30H25BrN2O6 — CID 95399479
4-(6-bromo-2-oxochromen-3-yl)-7-hydroxy-8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]chromen-2-one (PubChem CID 95399479) has the molecular formula C30H25BrN2O6 and a molecular weight of 589.44 g/mol. Its IUPAC name is 4-(6-bromo-2-oxochromen-3-yl)-7-hydroxy-8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]chromen-2-one.
| Compound Name | 4-(6-bromo-2-oxochromen-3-yl)-7-hydroxy-8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 95399479 |
| Molecular Formula | C30H25BrN2O6 |
| Molecular Weight | 589.44 g/mol |
| Exact Mass | 588.09 |
| IUPAC Name | 4-(6-bromo-2-oxochromen-3-yl)-7-hydroxy-8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]chromen-2-one |
| SMILES | COc1ccc(N2CCN(Cc3c(O)ccc4c(-c5cc6cc(Br)ccc6oc5=O)cc(=O)oc34)CC2)cc1 |
| InChI | InChI=1S/C30H25BrN2O6/c1-37-21-5-3-20(4-6-21)33-12-10-32(11-13-33)17-25-26(34)8-7-22-23(16-28(35)39-29(22)25)24-15-18-14-19(31)2-9-27(18)38-30(24)36/h2-9,14-16,34H,10-13,17H2,1H3 |
| InChIKey | HFTQTLURXIYAHQ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.44 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|