C27H25BrN2O5 — CID 95399499
3-(2-bromophenoxy)-7-hydroxy-8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]chromen-4-one (PubChem CID 95399499) has the molecular formula C27H25BrN2O5 and a molecular weight of 537.41 g/mol. Its IUPAC name is 3-(2-bromophenoxy)-7-hydroxy-8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]chromen-4-one.
| Compound Name | 3-(2-bromophenoxy)-7-hydroxy-8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]chromen-4-one |
|---|---|
| PubChem CID | 95399499 |
| Molecular Formula | C27H25BrN2O5 |
| Molecular Weight | 537.41 g/mol |
| Exact Mass | 536.09 |
| IUPAC Name | 3-(2-bromophenoxy)-7-hydroxy-8-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]chromen-4-one |
| SMILES | COc1ccc(N2CCN(Cc3c(O)ccc4c(=O)c(Oc5ccccc5Br)coc34)CC2)cc1 |
| InChI | InChI=1S/C27H25BrN2O5/c1-33-19-8-6-18(7-9-19)30-14-12-29(13-15-30)16-21-23(31)11-10-20-26(32)25(17-34-27(20)21)35-24-5-3-2-4-22(24)28/h2-11,17,31H,12-16H2,1H3 |
| InChIKey | FUGCINJEPISROK-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.41 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|