C23H25NO5 — CID 7542252
7-hydroxy-3-(4-methoxyphenoxy)-8-[[(3R)-3-methylpiperidin-1-yl]methyl]chromen-4-one (PubChem CID 7542252) has the molecular formula C23H25NO5 and a molecular weight of 395.46 g/mol. Its IUPAC name is 7-hydroxy-3-(4-methoxyphenoxy)-8-[[(3R)-3-methylpiperidin-1-yl]methyl]chromen-4-one.
| Compound Name | 7-hydroxy-3-(4-methoxyphenoxy)-8-[[(3R)-3-methylpiperidin-1-yl]methyl]chromen-4-one |
|---|---|
| PubChem CID | 7542252 |
| Molecular Formula | C23H25NO5 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 7-hydroxy-3-(4-methoxyphenoxy)-8-[[(3R)-3-methylpiperidin-1-yl]methyl]chromen-4-one |
| SMILES | COc1ccc(Oc2coc3c(CN4CCC[C@@H](C)C4)c(O)ccc3c2=O)cc1 |
| InChI | InChI=1S/C23H25NO5/c1-15-4-3-11-24(12-15)13-19-20(25)10-9-18-22(26)21(14-28-23(18)19)29-17-7-5-16(27-2)6-8-17/h5-10,14-15,25H,3-4,11-13H2,1-2H3/t15-/m1/s1 |
| InChIKey | WMLNZZILBDNROI-OAHLLOKOSA-N |
| XLogP | 4.53 |
| TPSA | 72.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|