C26H27NO8 — CID 110275951
ethyl 1-[[7-hydroxy-3-(4-methoxycarbonylphenoxy)-4-oxochromen-8-yl]methyl]piperidine-3-carboxylate (PubChem CID 110275951) has the molecular formula C26H27NO8 and a molecular weight of 481.50 g/mol. Its IUPAC name is ethyl 1-[[7-hydroxy-3-(4-methoxycarbonylphenoxy)-4-oxochromen-8-yl]methyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[[7-hydroxy-3-(4-methoxycarbonylphenoxy)-4-oxochromen-8-yl]methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 110275951 |
| Molecular Formula | C26H27NO8 |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | ethyl 1-[[7-hydroxy-3-(4-methoxycarbonylphenoxy)-4-oxochromen-8-yl]methyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(Cc2c(O)ccc3c(=O)c(Oc4ccc(C(=O)OC)cc4)coc23)C1 |
| InChI | InChI=1S/C26H27NO8/c1-3-33-26(31)17-5-4-12-27(13-17)14-20-21(28)11-10-19-23(29)22(15-34-24(19)20)35-18-8-6-16(7-9-18)25(30)32-2/h6-11,15,17,28H,3-5,12-14H2,1-2H3 |
| InChIKey | FDEYYBGXWMWKED-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 115.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|