C29H29NO8 — CID 110275897
ethyl 1-[[4-(8-ethoxy-2-oxochromen-3-yl)-7-hydroxy-2-oxochromen-8-yl]methyl]piperidine-3-carboxylate (PubChem CID 110275897) has the molecular formula C29H29NO8 and a molecular weight of 519.55 g/mol. Its IUPAC name is ethyl 1-[[4-(8-ethoxy-2-oxochromen-3-yl)-7-hydroxy-2-oxochromen-8-yl]methyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[[4-(8-ethoxy-2-oxochromen-3-yl)-7-hydroxy-2-oxochromen-8-yl]methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 110275897 |
| Molecular Formula | C29H29NO8 |
| Molecular Weight | 519.55 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | ethyl 1-[[4-(8-ethoxy-2-oxochromen-3-yl)-7-hydroxy-2-oxochromen-8-yl]methyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(Cc2c(O)ccc3c(-c4cc5cccc(OCC)c5oc4=O)cc(=O)oc23)C1 |
| InChI | InChI=1S/C29H29NO8/c1-3-35-24-9-5-7-17-13-21(29(34)38-26(17)24)20-14-25(32)37-27-19(20)10-11-23(31)22(27)16-30-12-6-8-18(15-30)28(33)36-4-2/h5,7,9-11,13-14,18,31H,3-4,6,8,12,15-16H2,1-2H3 |
| InChIKey | DKEGPHMWXVKAIQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 119.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|