C18H20ClNO5 — CID 110275917
ethyl 1-[(3-chloro-7-hydroxy-4-oxochromen-8-yl)methyl]piperidine-3-carboxylate (PubChem CID 110275917) has the molecular formula C18H20ClNO5 and a molecular weight of 365.81 g/mol. Its IUPAC name is ethyl 1-[(3-chloro-7-hydroxy-4-oxochromen-8-yl)methyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[(3-chloro-7-hydroxy-4-oxochromen-8-yl)methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 110275917 |
| Molecular Formula | C18H20ClNO5 |
| Molecular Weight | 365.81 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | ethyl 1-[(3-chloro-7-hydroxy-4-oxochromen-8-yl)methyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(Cc2c(O)ccc3c(=O)c(Cl)coc23)C1 |
| InChI | InChI=1S/C18H20ClNO5/c1-2-24-18(23)11-4-3-7-20(8-11)9-13-15(21)6-5-12-16(22)14(19)10-25-17(12)13/h5-6,10-11,21H,2-4,7-9H2,1H3 |
| InChIKey | RRULLYMQLNUMQJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.81 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|