C26H26F3NO6 — CID 110275920
ethyl 1-[[7-hydroxy-3-(2-methoxyphenyl)-4-oxo-2-(trifluoromethyl)chromen-8-yl]methyl]piperidine-3-carboxylate (PubChem CID 110275920) has the molecular formula C26H26F3NO6 and a molecular weight of 505.49 g/mol. Its IUPAC name is ethyl 1-[[7-hydroxy-3-(2-methoxyphenyl)-4-oxo-2-(trifluoromethyl)chromen-8-yl]methyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[[7-hydroxy-3-(2-methoxyphenyl)-4-oxo-2-(trifluoromethyl)chromen-8-yl]methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 110275920 |
| Molecular Formula | C26H26F3NO6 |
| Molecular Weight | 505.49 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | ethyl 1-[[7-hydroxy-3-(2-methoxyphenyl)-4-oxo-2-(trifluoromethyl)chromen-8-yl]methyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(Cc2c(O)ccc3c(=O)c(-c4ccccc4OC)c(C(F)(F)F)oc23)C1 |
| InChI | InChI=1S/C26H26F3NO6/c1-3-35-25(33)15-7-6-12-30(13-15)14-18-19(31)11-10-17-22(32)21(16-8-4-5-9-20(16)34-2)24(26(27,28)29)36-23(17)18/h4-5,8-11,15,31H,3,6-7,12-14H2,1-2H3 |
| InChIKey | RNLJGYXFDUIQPC-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|