C25H26F3NO4 — CID 7902679
3-(2,5-dimethylphenoxy)-7-hydroxy-8-[[(3R)-3-methylpiperidin-1-yl]methyl]-2-(trifluoromethyl)chromen-4-one (PubChem CID 7902679) has the molecular formula C25H26F3NO4 and a molecular weight of 461.48 g/mol. Its IUPAC name is 3-(2,5-dimethylphenoxy)-7-hydroxy-8-[[(3R)-3-methylpiperidin-1-yl]methyl]-2-(trifluoromethyl)chromen-4-one.
| Compound Name | 3-(2,5-dimethylphenoxy)-7-hydroxy-8-[[(3R)-3-methylpiperidin-1-yl]methyl]-2-(trifluoromethyl)chromen-4-one |
|---|---|
| PubChem CID | 7902679 |
| Molecular Formula | C25H26F3NO4 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 3-(2,5-dimethylphenoxy)-7-hydroxy-8-[[(3R)-3-methylpiperidin-1-yl]methyl]-2-(trifluoromethyl)chromen-4-one |
| SMILES | Cc1ccc(C)c(Oc2c(C(F)(F)F)oc3c(CN4CCC[C@@H](C)C4)c(O)ccc3c2=O)c1 |
| InChI | InChI=1S/C25H26F3NO4/c1-14-6-7-16(3)20(11-14)32-23-21(31)17-8-9-19(30)18(13-29-10-4-5-15(2)12-29)22(17)33-24(23)25(26,27)28/h6-9,11,15,30H,4-5,10,12-13H2,1-3H3/t15-/m1/s1 |
| InChIKey | JYYVYILMXSBENG-OAHLLOKOSA-N |
| XLogP | 6.16 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|