C21H20F3NO4 — CID 5451317
8-[(dimethylamino)methyl]-3-(2,5-dimethylphenoxy)-7-hydroxy-2-(trifluoromethyl)chromen-4-one (PubChem CID 5451317) has the molecular formula C21H20F3NO4 and a molecular weight of 407.39 g/mol. Its IUPAC name is 8-[(dimethylamino)methyl]-3-(2,5-dimethylphenoxy)-7-hydroxy-2-(trifluoromethyl)chromen-4-one.
| Compound Name | 8-[(dimethylamino)methyl]-3-(2,5-dimethylphenoxy)-7-hydroxy-2-(trifluoromethyl)chromen-4-one |
|---|---|
| PubChem CID | 5451317 |
| Molecular Formula | C21H20F3NO4 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 8-[(dimethylamino)methyl]-3-(2,5-dimethylphenoxy)-7-hydroxy-2-(trifluoromethyl)chromen-4-one |
| SMILES | Cc1ccc(C)c(Oc2c(C(F)(F)F)oc3c(CN(C)C)c(O)ccc3c2=O)c1 |
| InChI | InChI=1S/C21H20F3NO4/c1-11-5-6-12(2)16(9-11)28-19-17(27)13-7-8-15(26)14(10-25(3)4)18(13)29-20(19)21(22,23)24/h5-9,26H,10H2,1-4H3 |
| InChIKey | AQFYCQMLZRSIOJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|