C26H25NO5 — CID 40892755
8-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]methyl]-7-hydroxy-4-(2-oxochromen-3-yl)chromen-2-one (PubChem CID 40892755) has the molecular formula C26H25NO5 and a molecular weight of 431.49 g/mol. Its IUPAC name is 8-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]methyl]-7-hydroxy-4-(2-oxochromen-3-yl)chromen-2-one.
| Compound Name | 8-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]methyl]-7-hydroxy-4-(2-oxochromen-3-yl)chromen-2-one |
|---|---|
| PubChem CID | 40892755 |
| Molecular Formula | C26H25NO5 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 8-[[(3R,5R)-3,5-dimethylpiperidin-1-yl]methyl]-7-hydroxy-4-(2-oxochromen-3-yl)chromen-2-one |
| SMILES | C[C@@H]1C[C@@H](C)CN(Cc2c(O)ccc3c(-c4cc5ccccc5oc4=O)cc(=O)oc23)C1 |
| InChI | InChI=1S/C26H25NO5/c1-15-9-16(2)13-27(12-15)14-21-22(28)8-7-18-19(11-24(29)32-25(18)21)20-10-17-5-3-4-6-23(17)31-26(20)30/h3-8,10-11,15-16,28H,9,12-14H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | CGYBCGQMQSDUJC-HZPDHXFCSA-N |
| XLogP | 4.75 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|