C27H29NO5 — CID 44665786
8-[[bis(2-methylpropyl)azaniumyl]methyl]-2-oxo-4-(2-oxochromen-3-yl)chromen-7-olate (PubChem CID 44665786) has the molecular formula C27H29NO5 and a molecular weight of 447.53 g/mol. Its IUPAC name is 8-[[bis(2-methylpropyl)azaniumyl]methyl]-2-oxo-4-(2-oxochromen-3-yl)chromen-7-olate.
| Compound Name | 8-[[bis(2-methylpropyl)azaniumyl]methyl]-2-oxo-4-(2-oxochromen-3-yl)chromen-7-olate |
|---|---|
| PubChem CID | 44665786 |
| Molecular Formula | C27H29NO5 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 8-[[bis(2-methylpropyl)azaniumyl]methyl]-2-oxo-4-(2-oxochromen-3-yl)chromen-7-olate |
| SMILES | CC(C)C[NH+](Cc1c([O-])ccc2c(-c3cc4ccccc4oc3=O)cc(=O)oc12)CC(C)C |
| InChI | InChI=1S/C27H29NO5/c1-16(2)13-28(14-17(3)4)15-22-23(29)10-9-19-20(12-25(30)33-26(19)22)21-11-18-7-5-6-8-24(18)32-27(21)31/h5-12,16-17,29H,13-15H2,1-4H3 |
| InChIKey | FOYMDGCVLKGUMB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 87.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|