C24H25NO7 — CID 97161875
(3R)-1-[[3-(2,5-dimethoxyphenyl)-7-hydroxy-2-oxochromen-8-yl]methyl]piperidine-3-carboxylic acid (PubChem CID 97161875) has the molecular formula C24H25NO7 and a molecular weight of 439.46 g/mol. Its IUPAC name is (3R)-1-[[3-(2,5-dimethoxyphenyl)-7-hydroxy-2-oxochromen-8-yl]methyl]piperidine-3-carboxylic acid.
| Compound Name | (3R)-1-[[3-(2,5-dimethoxyphenyl)-7-hydroxy-2-oxochromen-8-yl]methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 97161875 |
| Molecular Formula | C24H25NO7 |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | (3R)-1-[[3-(2,5-dimethoxyphenyl)-7-hydroxy-2-oxochromen-8-yl]methyl]piperidine-3-carboxylic acid |
| SMILES | COc1ccc(OC)c(-c2cc3ccc(O)c(CN4CCC[C@@H](C(=O)O)C4)c3oc2=O)c1 |
| InChI | InChI=1S/C24H25NO7/c1-30-16-6-8-21(31-2)17(11-16)18-10-14-5-7-20(26)19(22(14)32-24(18)29)13-25-9-3-4-15(12-25)23(27)28/h5-8,10-11,15,26H,3-4,9,12-13H2,1-2H3,(H,27,28)/t15-/m1/s1 |
| InChIKey | BXRUOTGNUPNFLC-OAHLLOKOSA-N |
| XLogP | 3.48 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|