C23H24NO5- — CID 1383524
8-(azepan-1-ylmethyl)-3-(4-methoxyphenoxy)-4-oxochromen-7-olate (PubChem CID 1383524) has the molecular formula C23H24NO5- and a molecular weight of 394.45 g/mol. Its IUPAC name is 8-(azepan-1-ylmethyl)-3-(4-methoxyphenoxy)-4-oxochromen-7-olate.
| Compound Name | 8-(azepan-1-ylmethyl)-3-(4-methoxyphenoxy)-4-oxochromen-7-olate |
|---|---|
| PubChem CID | 1383524 |
| Molecular Formula | C23H24NO5- |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 8-(azepan-1-ylmethyl)-3-(4-methoxyphenoxy)-4-oxochromen-7-olate |
| SMILES | COc1ccc(Oc2coc3c(CN4CCCCCC4)c([O-])ccc3c2=O)cc1 |
| InChI | InChI=1S/C23H25NO5/c1-27-16-6-8-17(9-7-16)29-21-15-28-23-18(22(21)26)10-11-20(25)19(23)14-24-12-4-2-3-5-13-24/h6-11,15,25H,2-5,12-14H2,1H3/p-1 |
| InChIKey | RDGFNMUELKUYHF-UHFFFAOYSA-M |
| XLogP | 4.04 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |