C24H27NO5 — CID 1399766
8-(azepan-1-ium-1-ylmethyl)-3-(4-methoxyphenoxy)-2-methyl-4-oxochromen-7-olate (PubChem CID 1399766) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is 8-(azepan-1-ium-1-ylmethyl)-3-(4-methoxyphenoxy)-2-methyl-4-oxochromen-7-olate.
| Compound Name | 8-(azepan-1-ium-1-ylmethyl)-3-(4-methoxyphenoxy)-2-methyl-4-oxochromen-7-olate |
|---|---|
| PubChem CID | 1399766 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 8-(azepan-1-ium-1-ylmethyl)-3-(4-methoxyphenoxy)-2-methyl-4-oxochromen-7-olate |
| SMILES | COc1ccc(Oc2c(C)oc3c(C[NH+]4CCCCCC4)c([O-])ccc3c2=O)cc1 |
| InChI | InChI=1S/C24H27NO5/c1-16-23(30-18-9-7-17(28-2)8-10-18)22(27)19-11-12-21(26)20(24(19)29-16)15-25-13-5-3-4-6-14-25/h7-12,26H,3-6,13-15H2,1-2H3 |
| InChIKey | XXSZKTRVOOQBIE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 76.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |