C23H26NO5+ — CID 7662008
7-hydroxy-3-(3-methoxyphenoxy)-8-[[(3S)-3-methylpiperidin-1-ium-1-yl]methyl]chromen-4-one (PubChem CID 7662008) has the molecular formula C23H26NO5+ and a molecular weight of 396.46 g/mol. Its IUPAC name is 7-hydroxy-3-(3-methoxyphenoxy)-8-[[(3S)-3-methylpiperidin-1-ium-1-yl]methyl]chromen-4-one.
| Compound Name | 7-hydroxy-3-(3-methoxyphenoxy)-8-[[(3S)-3-methylpiperidin-1-ium-1-yl]methyl]chromen-4-one |
|---|---|
| PubChem CID | 7662008 |
| Molecular Formula | C23H26NO5+ |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 7-hydroxy-3-(3-methoxyphenoxy)-8-[[(3S)-3-methylpiperidin-1-ium-1-yl]methyl]chromen-4-one |
| SMILES | COc1cccc(Oc2coc3c(C[NH+]4CCC[C@H](C)C4)c(O)ccc3c2=O)c1 |
| InChI | InChI=1S/C23H25NO5/c1-15-5-4-10-24(12-15)13-19-20(25)9-8-18-22(26)21(14-28-23(18)19)29-17-7-3-6-16(11-17)27-2/h3,6-9,11,14-15,25H,4-5,10,12-13H2,1-2H3/p+1/t15-/m0/s1 |
| InChIKey | QNZOGZCTVUHVJK-HNNXBMFYSA-O |
| XLogP | 3.11 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|