C24H28NO4+ — CID 6277023
8-(azepan-1-ium-1-ylmethyl)-3-(3,5-dimethylphenoxy)-7-hydroxychromen-4-one (PubChem CID 6277023) has the molecular formula C24H28NO4+ and a molecular weight of 394.49 g/mol. Its IUPAC name is 8-(azepan-1-ium-1-ylmethyl)-3-(3,5-dimethylphenoxy)-7-hydroxychromen-4-one.
| Compound Name | 8-(azepan-1-ium-1-ylmethyl)-3-(3,5-dimethylphenoxy)-7-hydroxychromen-4-one |
|---|---|
| PubChem CID | 6277023 |
| Molecular Formula | C24H28NO4+ |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 8-(azepan-1-ium-1-ylmethyl)-3-(3,5-dimethylphenoxy)-7-hydroxychromen-4-one |
| SMILES | Cc1cc(C)cc(Oc2coc3c(C[NH+]4CCCCCC4)c(O)ccc3c2=O)c1 |
| InChI | InChI=1S/C24H27NO4/c1-16-11-17(2)13-18(12-16)29-22-15-28-24-19(23(22)27)7-8-21(26)20(24)14-25-9-5-3-4-6-10-25/h7-8,11-13,15,26H,3-6,9-10,14H2,1-2H3/p+1 |
| InChIKey | FTHHQKPPLNRMJA-UHFFFAOYSA-O |
| XLogP | 3.87 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|