C22H21NO7 — CID 6571910
(2R)-1-[[7-hydroxy-3-(2-methoxyphenoxy)-4-oxochromen-8-yl]methyl]pyrrolidine-2-carboxylic acid (PubChem CID 6571910) has the molecular formula C22H21NO7 and a molecular weight of 411.41 g/mol. Its IUPAC name is (2R)-1-[[7-hydroxy-3-(2-methoxyphenoxy)-4-oxochromen-8-yl]methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[[7-hydroxy-3-(2-methoxyphenoxy)-4-oxochromen-8-yl]methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 6571910 |
| Molecular Formula | C22H21NO7 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | (2R)-1-[[7-hydroxy-3-(2-methoxyphenoxy)-4-oxochromen-8-yl]methyl]pyrrolidine-2-carboxylic acid |
| SMILES | COc1ccccc1Oc1coc2c(CN3CCC[C@@H]3C(=O)O)c(O)ccc2c1=O |
| InChI | InChI=1S/C22H21NO7/c1-28-17-6-2-3-7-18(17)30-19-12-29-21-13(20(19)25)8-9-16(24)14(21)11-23-10-4-5-15(23)22(26)27/h2-3,6-9,12,15,24H,4-5,10-11H2,1H3,(H,26,27)/t15-/m1/s1 |
| InChIKey | XPOQYTGPGIRHPZ-OAHLLOKOSA-N |
| XLogP | 3.35 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|