C24H25NO7 — CID 21204055
1-[[3-(4-ethoxyphenoxy)-7-hydroxy-2-methyl-4-oxochromen-8-yl]methyl]pyrrolidine-2-carboxylic acid (PubChem CID 21204055) has the molecular formula C24H25NO7 and a molecular weight of 439.46 g/mol. Its IUPAC name is 1-[[3-(4-ethoxyphenoxy)-7-hydroxy-2-methyl-4-oxochromen-8-yl]methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | 1-[[3-(4-ethoxyphenoxy)-7-hydroxy-2-methyl-4-oxochromen-8-yl]methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 21204055 |
| Molecular Formula | C24H25NO7 |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 1-[[3-(4-ethoxyphenoxy)-7-hydroxy-2-methyl-4-oxochromen-8-yl]methyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCOc1ccc(Oc2c(C)oc3c(CN4CCCC4C(=O)O)c(O)ccc3c2=O)cc1 |
| InChI | InChI=1S/C24H25NO7/c1-3-30-15-6-8-16(9-7-15)32-22-14(2)31-23-17(21(22)27)10-11-20(26)18(23)13-25-12-4-5-19(25)24(28)29/h6-11,19,26H,3-5,12-13H2,1-2H3,(H,28,29) |
| InChIKey | ZKUFTRHWDZJCOR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|