C30H30N2O7 — CID 95399327
8-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl]-7-hydroxy-3-(4-methoxyphenoxy)-2-methylchromen-4-one (PubChem CID 95399327) has the molecular formula C30H30N2O7 and a molecular weight of 530.58 g/mol. Its IUPAC name is 8-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl]-7-hydroxy-3-(4-methoxyphenoxy)-2-methylchromen-4-one.
| Compound Name | 8-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl]-7-hydroxy-3-(4-methoxyphenoxy)-2-methylchromen-4-one |
|---|---|
| PubChem CID | 95399327 |
| Molecular Formula | C30H30N2O7 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | 8-[[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]methyl]-7-hydroxy-3-(4-methoxyphenoxy)-2-methylchromen-4-one |
| SMILES | COc1ccc(Oc2c(C)oc3c(CN4CCN(Cc5ccc6c(c5)OCO6)CC4)c(O)ccc3c2=O)cc1 |
| InChI | InChI=1S/C30H30N2O7/c1-19-29(39-22-6-4-21(35-2)5-7-22)28(34)23-8-9-25(33)24(30(23)38-19)17-32-13-11-31(12-14-32)16-20-3-10-26-27(15-20)37-18-36-26/h3-10,15,33H,11-14,16-18H2,1-2H3 |
| InChIKey | MEWJUTICSHAXCW-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|