C23H22ClN3O5 — CID 16654847
3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-4-chloro-1-(4-methoxyphenyl)pyrrole-2,5-dione (PubChem CID 16654847) has the molecular formula C23H22ClN3O5 and a molecular weight of 455.90 g/mol. Its IUPAC name is 3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-4-chloro-1-(4-methoxyphenyl)pyrrole-2,5-dione.
| Compound Name | 3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-4-chloro-1-(4-methoxyphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 16654847 |
| Molecular Formula | C23H22ClN3O5 |
| Molecular Weight | 455.90 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 3-[4-(1,3-benzodioxol-5-ylmethyl)piperazin-1-yl]-4-chloro-1-(4-methoxyphenyl)pyrrole-2,5-dione |
| SMILES | COc1ccc(N2C(=O)C(Cl)=C(N3CCN(Cc4ccc5c(c4)OCO5)CC3)C2=O)cc1 |
| InChI | InChI=1S/C23H22ClN3O5/c1-30-17-5-3-16(4-6-17)27-22(28)20(24)21(23(27)29)26-10-8-25(9-11-26)13-15-2-7-18-19(12-15)32-14-31-18/h2-7,12H,8-11,13-14H2,1H3 |
| InChIKey | CCMIGNRGVSHZNI-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.90 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|