C22H29IN4O3 — CID 111188976
4-(1,3-benzodioxol-5-ylmethyl)-N-[(4-methoxyphenyl)methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111188976) has the molecular formula C22H29IN4O3 and a molecular weight of 524.40 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethyl)-N-[(4-methoxyphenyl)methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethyl)-N-[(4-methoxyphenyl)methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111188976 |
| Molecular Formula | C22H29IN4O3 |
| Molecular Weight | 524.40 g/mol |
| Exact Mass | 524.13 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethyl)-N-[(4-methoxyphenyl)methyl]-N'-methylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(OC)cc1)N1CCN(Cc2ccc3c(c2)OCO3)CC1.I |
| InChI | InChI=1S/C22H28N4O3.HI/c1-23-22(24-14-17-3-6-19(27-2)7-4-17)26-11-9-25(10-12-26)15-18-5-8-20-21(13-18)29-16-28-20;/h3-8,13H,9-12,14-16H2,1-2H3,(H,23,24);1H |
| InChIKey | UFVCVTVTWYWTBM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|