C22H31N5O3 — CID 111189088
4-(1,3-benzodioxol-5-ylmethyl)-N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-N'-methylpiperazine-1-carboximidamide (PubChem CID 111189088) has the molecular formula C22H31N5O3 and a molecular weight of 413.52 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethyl)-N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-N'-methylpiperazine-1-carboximidamide.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethyl)-N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111189088 |
| Molecular Formula | C22H31N5O3 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.24 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethyl)-N-[2-(dimethylamino)-2-(furan-2-yl)ethyl]-N'-methylpiperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC(c1ccco1)N(C)C)N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C22H31N5O3/c1-23-22(24-14-18(25(2)3)19-5-4-12-28-19)27-10-8-26(9-11-27)15-17-6-7-20-21(13-17)30-16-29-20/h4-7,12-13,18H,8-11,14-16H2,1-3H3,(H,23,24) |
| InChIKey | AZZWCTOVIKJRFZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|