C24H29N5O2 — CID 111188867
4-(1,3-benzodioxol-5-ylmethyl)-N-[2-(1H-indol-3-yl)ethyl]-N'-methylpiperazine-1-carboximidamide (PubChem CID 111188867) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethyl)-N-[2-(1H-indol-3-yl)ethyl]-N'-methylpiperazine-1-carboximidamide.
| Compound Name | 4-(1,3-benzodioxol-5-ylmethyl)-N-[2-(1H-indol-3-yl)ethyl]-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111188867 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethyl)-N-[2-(1H-indol-3-yl)ethyl]-N'-methylpiperazine-1-carboximidamide |
| SMILES | C/N=C(/NCCc1c[nH]c2ccccc12)N1CCN(Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C24H29N5O2/c1-25-24(26-9-8-19-15-27-21-5-3-2-4-20(19)21)29-12-10-28(11-13-29)16-18-6-7-22-23(14-18)31-17-30-22/h2-7,14-15,27H,8-13,16-17H2,1H3,(H,25,26) |
| InChIKey | FZEJZWHXHUXTEV-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|