C23H25F3NO5+ — CID 6259196
[3-(3,4-dimethoxyphenyl)-7-hydroxy-4-oxo-2-(trifluoromethyl)chromen-8-yl]methyl-diethylazanium (PubChem CID 6259196) has the molecular formula C23H25F3NO5+ and a molecular weight of 452.45 g/mol. Its IUPAC name is [3-(3,4-dimethoxyphenyl)-7-hydroxy-4-oxo-2-(trifluoromethyl)chromen-8-yl]methyl-diethylazanium.
| Compound Name | [3-(3,4-dimethoxyphenyl)-7-hydroxy-4-oxo-2-(trifluoromethyl)chromen-8-yl]methyl-diethylazanium |
|---|---|
| PubChem CID | 6259196 |
| Molecular Formula | C23H25F3NO5+ |
| Molecular Weight | 452.45 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | [3-(3,4-dimethoxyphenyl)-7-hydroxy-4-oxo-2-(trifluoromethyl)chromen-8-yl]methyl-diethylazanium |
| SMILES | CC[NH+](CC)Cc1c(O)ccc2c(=O)c(-c3ccc(OC)c(OC)c3)c(C(F)(F)F)oc12 |
| InChI | InChI=1S/C23H24F3NO5/c1-5-27(6-2)12-15-16(28)9-8-14-20(29)19(22(23(24,25)26)32-21(14)15)13-7-10-17(30-3)18(11-13)31-4/h7-11,28H,5-6,12H2,1-4H3/p+1 |
| InChIKey | PVDGCCSFBCNVHP-UHFFFAOYSA-O |
| XLogP | 3.63 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|