C23H22BrF3NO4+ — CID 7896961
3-(2-bromophenoxy)-7-hydroxy-8-[[(2S)-2-methylpiperidin-1-ium-1-yl]methyl]-2-(trifluoromethyl)chromen-4-one (PubChem CID 7896961) has the molecular formula C23H22BrF3NO4+ and a molecular weight of 513.33 g/mol. Its IUPAC name is 3-(2-bromophenoxy)-7-hydroxy-8-[[(2S)-2-methylpiperidin-1-ium-1-yl]methyl]-2-(trifluoromethyl)chromen-4-one.
| Compound Name | 3-(2-bromophenoxy)-7-hydroxy-8-[[(2S)-2-methylpiperidin-1-ium-1-yl]methyl]-2-(trifluoromethyl)chromen-4-one |
|---|---|
| PubChem CID | 7896961 |
| Molecular Formula | C23H22BrF3NO4+ |
| Molecular Weight | 513.33 g/mol |
| Exact Mass | 512.07 |
| IUPAC Name | 3-(2-bromophenoxy)-7-hydroxy-8-[[(2S)-2-methylpiperidin-1-ium-1-yl]methyl]-2-(trifluoromethyl)chromen-4-one |
| SMILES | C[C@H]1CCCC[NH+]1Cc1c(O)ccc2c(=O)c(Oc3ccccc3Br)c(C(F)(F)F)oc12 |
| InChI | InChI=1S/C23H21BrF3NO4/c1-13-6-4-5-11-28(13)12-15-17(29)10-9-14-19(30)21(22(23(25,26)27)32-20(14)15)31-18-8-3-2-7-16(18)24/h2-3,7-10,13,29H,4-6,11-12H2,1H3/p+1/t13-/m0/s1 |
| InChIKey | AMYVVRXJMVQHCS-ZDUSSCGKSA-O |
| XLogP | 5.03 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.33 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|