C23H26NO5+ — CID 7094340
3-(2,5-dimethoxyphenyl)-7-hydroxy-4-methyl-8-(pyrrolidin-1-ium-1-ylmethyl)chromen-2-one (PubChem CID 7094340) has the molecular formula C23H26NO5+ and a molecular weight of 396.46 g/mol. Its IUPAC name is 3-(2,5-dimethoxyphenyl)-7-hydroxy-4-methyl-8-(pyrrolidin-1-ium-1-ylmethyl)chromen-2-one.
| Compound Name | 3-(2,5-dimethoxyphenyl)-7-hydroxy-4-methyl-8-(pyrrolidin-1-ium-1-ylmethyl)chromen-2-one |
|---|---|
| PubChem CID | 7094340 |
| Molecular Formula | C23H26NO5+ |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 3-(2,5-dimethoxyphenyl)-7-hydroxy-4-methyl-8-(pyrrolidin-1-ium-1-ylmethyl)chromen-2-one |
| SMILES | COc1ccc(OC)c(-c2c(C)c3ccc(O)c(C[NH+]4CCCC4)c3oc2=O)c1 |
| InChI | InChI=1S/C23H25NO5/c1-14-16-7-8-19(25)18(13-24-10-4-5-11-24)22(16)29-23(26)21(14)17-12-15(27-2)6-9-20(17)28-3/h6-9,12,25H,4-5,10-11,13H2,1-3H3/p+1 |
| InChIKey | IUWSBDNLAWVPPZ-UHFFFAOYSA-O |
| XLogP | 2.67 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|