C13H12O4S — CID 621994
4,9,9-trimethyl-8H-[1,3]oxathiolo[4,5-f]chromene-2,7-dione (PubChem CID 621994) has the molecular formula C13H12O4S and a molecular weight of 264.30 g/mol. Its IUPAC name is 4,9,9-trimethyl-8H-[1,3]oxathiolo[4,5-f]chromene-2,7-dione.
| Compound Name | 4,9,9-trimethyl-8H-[1,3]oxathiolo[4,5-f]chromene-2,7-dione |
|---|---|
| PubChem CID | 621994 |
| Molecular Formula | C13H12O4S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 4,9,9-trimethyl-8H-[1,3]oxathiolo[4,5-f]chromene-2,7-dione |
| SMILES | Cc1cc2c(c3sc(=O)oc13)C(C)(C)CC(=O)O2 |
| InChI | InChI=1S/C13H12O4S/c1-6-4-7-9(11-10(6)17-12(15)18-11)13(2,3)5-8(14)16-7/h4H,5H2,1-3H3 |
| InChIKey | CJWVUMPRGBBGTH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_carbonate_A(15)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|