C12H13BrO2 — CID 168825992
5-bromo-4,4,7-trimethyl-3H-chromen-2-one (PubChem CID 168825992) has the molecular formula C12H13BrO2 and a molecular weight of 269.14 g/mol. Its IUPAC name is 5-bromo-4,4,7-trimethyl-3H-chromen-2-one.
| Compound Name | 5-bromo-4,4,7-trimethyl-3H-chromen-2-one |
|---|---|
| PubChem CID | 168825992 |
| Molecular Formula | C12H13BrO2 |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 5-bromo-4,4,7-trimethyl-3H-chromen-2-one |
| SMILES | Cc1cc(Br)c2c(c1)OC(=O)CC2(C)C |
| InChI | InChI=1S/C12H13BrO2/c1-7-4-8(13)11-9(5-7)15-10(14)6-12(11,2)3/h4-5H,6H2,1-3H3 |
| InChIKey | JQFTVFOTXOKXFO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|