C25H26O6S — CID 1043326
9-(7-methoxy-2-oxo-1,3-benzoxathiol-5-yl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione (PubChem CID 1043326) has the molecular formula C25H26O6S and a molecular weight of 454.54 g/mol. Its IUPAC name is 9-(7-methoxy-2-oxo-1,3-benzoxathiol-5-yl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione.
| Compound Name | 9-(7-methoxy-2-oxo-1,3-benzoxathiol-5-yl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 1043326 |
| Molecular Formula | C25H26O6S |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 9-(7-methoxy-2-oxo-1,3-benzoxathiol-5-yl)-3,3,6,6-tetramethyl-4,5,7,9-tetrahydro-2H-xanthene-1,8-dione |
| SMILES | COc1cc(C2C3=C(CC(C)(C)CC3=O)OC3=C2C(=O)CC(C)(C)C3)cc2sc(=O)oc12 |
| InChI | InChI=1S/C25H26O6S/c1-24(2)8-13(26)20-16(10-24)30-17-11-25(3,4)9-14(27)21(17)19(20)12-6-15(29-5)22-18(7-12)32-23(28)31-22/h6-7,19H,8-11H2,1-5H3 |
| InChIKey | IZKNYYPDSRGIFQ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_carbonate_B(3)', 'substructure': 'N/A'} |
|---|