C23H24O6 — CID 10000814
1,3,5,6-tetrahydroxy-4-(5-methyl-2-prop-1-en-2-ylhex-4-enyl)xanthen-9-one (PubChem CID 10000814) has the molecular formula C23H24O6 and a molecular weight of 396.44 g/mol. Its IUPAC name is 1,3,5,6-tetrahydroxy-4-(5-methyl-2-prop-1-en-2-ylhex-4-enyl)xanthen-9-one.
| Compound Name | 1,3,5,6-tetrahydroxy-4-(5-methyl-2-prop-1-en-2-ylhex-4-enyl)xanthen-9-one |
|---|---|
| PubChem CID | 10000814 |
| Molecular Formula | C23H24O6 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 1,3,5,6-tetrahydroxy-4-(5-methyl-2-prop-1-en-2-ylhex-4-enyl)xanthen-9-one |
| SMILES | C=C(C)C(CC=C(C)C)Cc1c(O)cc(O)c2c(=O)c3ccc(O)c(O)c3oc12 |
| InChI | InChI=1S/C23H24O6/c1-11(2)5-6-13(12(3)4)9-15-17(25)10-18(26)19-20(27)14-7-8-16(24)21(28)23(14)29-22(15)19/h5,7-8,10,13,24-26,28H,3,6,9H2,1-2,4H3 |
| InChIKey | ZXCREOQQIQQVAR-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|