C36H28O10 — CID 162902804
3-[(E)-2-[(1R,2R)-1,4-dimethyl-2-(1,4,5-trihydroxy-9-oxoxanthen-3-yl)cyclohex-3-en-1-yl]ethenyl]-1,4,5-trihydroxyxanthen-9-one (PubChem CID 162902804) has the molecular formula C36H28O10 and a molecular weight of 620.61 g/mol. Its IUPAC name is 3-[(E)-2-[(1R,2R)-1,4-dimethyl-2-(1,4,5-trihydroxy-9-oxoxanthen-3-yl)cyclohex-3-en-1-yl]ethenyl]-1,4,5-trihydroxyxanthen-9-one.
| Compound Name | 3-[(E)-2-[(1R,2R)-1,4-dimethyl-2-(1,4,5-trihydroxy-9-oxoxanthen-3-yl)cyclohex-3-en-1-yl]ethenyl]-1,4,5-trihydroxyxanthen-9-one |
|---|---|
| PubChem CID | 162902804 |
| Molecular Formula | C36H28O10 |
| Molecular Weight | 620.61 g/mol |
| Exact Mass | 620.17 |
| IUPAC Name | 3-[(E)-2-[(1R,2R)-1,4-dimethyl-2-(1,4,5-trihydroxy-9-oxoxanthen-3-yl)cyclohex-3-en-1-yl]ethenyl]-1,4,5-trihydroxyxanthen-9-one |
| SMILES | CC1=C[C@@H](c2cc(O)c3c(=O)c4cccc(O)c4oc3c2O)[C@@](C)(/C=C/c2cc(O)c3c(=O)c4cccc(O)c4oc3c2O)CC1 |
| InChI | InChI=1S/C36H28O10/c1-16-9-11-36(2,12-10-17-14-24(39)26-29(42)18-5-3-7-22(37)32(18)45-34(26)28(17)41)21(13-16)20-15-25(40)27-30(43)19-6-4-8-23(38)33(19)46-35(27)31(20)44/h3-8,10,12-15,21,37-41,44H,9,11H2,1-2H3/b12-10+/t21-,36+/m0/s1 |
| InChIKey | XYRCPMXSIHHGSO-FIHMOKRGSA-N |
| XLogP | 6.98 |
| TPSA | 181.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.61 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|