C19H14O6 — CID 11186777
(3S,7S)-11-hydroxy-18-methoxy-6-methylidene-4,8,20-trioxapentacyclo[10.8.0.02,9.03,7.014,19]icosa-1(12),2(9),10,14(19),15,17-hexaen-13-one (PubChem CID 11186777) has the molecular formula C19H14O6 and a molecular weight of 338.32 g/mol. Its IUPAC name is (3S,7S)-11-hydroxy-18-methoxy-6-methylidene-4,8,20-trioxapentacyclo[10.8.0.02,9.03,7.014,19]icosa-1(12),2(9),10,14(19),15,17-hexaen-13-one.
| Compound Name | (3S,7S)-11-hydroxy-18-methoxy-6-methylidene-4,8,20-trioxapentacyclo[10.8.0.02,9.03,7.014,19]icosa-1(12),2(9),10,14(19),15,17-hexaen-13-one |
|---|---|
| PubChem CID | 11186777 |
| Molecular Formula | C19H14O6 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | (3S,7S)-11-hydroxy-18-methoxy-6-methylidene-4,8,20-trioxapentacyclo[10.8.0.02,9.03,7.014,19]icosa-1(12),2(9),10,14(19),15,17-hexaen-13-one |
| SMILES | C=C1CO[C@H]2c3c(cc(O)c4c(=O)c5cccc(OC)c5oc34)O[C@@H]12 |
| InChI | InChI=1S/C19H14O6/c1-8-7-23-19-14-12(24-16(8)19)6-10(20)13-15(21)9-4-3-5-11(22-2)17(9)25-18(13)14/h3-6,16,19-20H,1,7H2,2H3/t16-,19-/m0/s1 |
| InChIKey | IMMOVEYTBYSSOD-LPHOPBHVSA-N |
| XLogP | 3.05 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|