C20H20O6 — CID 163055733
(2R)-2-(2-hydroxypropan-2-yl)-5,10-dimethoxy-1,2-dihydrofuro[2,3-c]xanthen-6-one (PubChem CID 163055733) has the molecular formula C20H20O6 and a molecular weight of 356.37 g/mol. Its IUPAC name is (2R)-2-(2-hydroxypropan-2-yl)-5,10-dimethoxy-1,2-dihydrofuro[2,3-c]xanthen-6-one.
| Compound Name | (2R)-2-(2-hydroxypropan-2-yl)-5,10-dimethoxy-1,2-dihydrofuro[2,3-c]xanthen-6-one |
|---|---|
| PubChem CID | 163055733 |
| Molecular Formula | C20H20O6 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | (2R)-2-(2-hydroxypropan-2-yl)-5,10-dimethoxy-1,2-dihydrofuro[2,3-c]xanthen-6-one |
| SMILES | COc1cccc2c(=O)c3c(OC)cc4c(c3oc12)C[C@H](C(C)(C)O)O4 |
| InChI | InChI=1S/C20H20O6/c1-20(2,22)15-8-11-13(25-15)9-14(24-4)16-17(21)10-6-5-7-12(23-3)18(10)26-19(11)16/h5-7,9,15,22H,8H2,1-4H3/t15-/m1/s1 |
| InChIKey | NVCVNROHXLRYQK-OAHLLOKOSA-N |
| XLogP | 3.04 |
| TPSA | 78.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|