C14H8ClNO4 — CID 3780301
7-chloro-2-methyl-5-oxochromeno[2,3-b]pyridine-3-carboxylic acid (PubChem CID 3780301) has the molecular formula C14H8ClNO4 and a molecular weight of 289.67 g/mol. Its IUPAC name is 7-chloro-2-methyl-5-oxochromeno[2,3-b]pyridine-3-carboxylic acid.
| Compound Name | 7-chloro-2-methyl-5-oxochromeno[2,3-b]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 3780301 |
| Molecular Formula | C14H8ClNO4 |
| Molecular Weight | 289.67 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 7-chloro-2-methyl-5-oxochromeno[2,3-b]pyridine-3-carboxylic acid |
| SMILES | Cc1nc2oc3ccc(Cl)cc3c(=O)c2cc1C(=O)O |
| InChI | InChI=1S/C14H8ClNO4/c1-6-8(14(18)19)5-10-12(17)9-4-7(15)2-3-11(9)20-13(10)16-6/h2-5H,1H3,(H,18,19) |
| InChIKey | KCLDKWDFEUHNBK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.67 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|