C17H14ClNO4 — CID 7747297
propan-2-yl 7-chloro-2-methyl-5-oxochromeno[2,3-b]pyridine-3-carboxylate (PubChem CID 7747297) has the molecular formula C17H14ClNO4 and a molecular weight of 331.76 g/mol. Its IUPAC name is propan-2-yl 7-chloro-2-methyl-5-oxochromeno[2,3-b]pyridine-3-carboxylate.
| Compound Name | propan-2-yl 7-chloro-2-methyl-5-oxochromeno[2,3-b]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 7747297 |
| Molecular Formula | C17H14ClNO4 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | propan-2-yl 7-chloro-2-methyl-5-oxochromeno[2,3-b]pyridine-3-carboxylate |
| SMILES | Cc1nc2oc3ccc(Cl)cc3c(=O)c2cc1C(=O)OC(C)C |
| InChI | InChI=1S/C17H14ClNO4/c1-8(2)22-17(21)11-7-13-15(20)12-6-10(18)4-5-14(12)23-16(13)19-9(11)3/h4-8H,1-3H3 |
| InChIKey | YPYPGRDUBAXSSD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|