About 2-(3-methoxycarbonyl-5-oxo-7-propan-2-ylchromeno[2,3-b]pyridin-2-yl)acetic acid
2-(3-methoxycarbonyl-5-oxo-7-propan-2-ylchromeno[2,3-b]pyridin-2-yl)acetic acid (PubChem CID 70513059) has the molecular formula C19H17NO6
and a molecular weight of 355.35 g/mol. Its IUPAC name is 2-(3-methoxycarbonyl-5-oxo-7-propan-2-ylchromeno[2,3-b]pyridin-2-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(3-methoxycarbonyl-5-oxo-7-propan-2-ylchromeno[2,3-b]pyridin-2-yl)acetic acid |
| PubChem CID | 70513059 |
| Molecular Formula | C19H17NO6 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 2-(3-methoxycarbonyl-5-oxo-7-propan-2-ylchromeno[2,3-b]pyridin-2-yl)acetic acid |
| SMILES | COC(=O)c1cc2c(=O)c3cc(C(C)C)ccc3oc2nc1CC(=O)O |
| InChI | InChI=1S/C19H17NO6/c1-9(2)10-4-5-15-12(6-10)17(23)13-7-11(19(24)25-3)14(8-16(21)22)20-18(13)26-15/h4-7,9H,8H2,1-3H3,(H,21,22) |
| InChIKey | KEDQQRXVOCIBAA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methoxycarbonyl-5-oxo-7-propan-2-ylchromeno[2,3-b]pyridin-2-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methoxycarbonyl-5-oxo-7-propan-2-ylchromeno[2,3-b]pyridin-2-yl)acetic acid?
The IUPAC name of 2-(3-methoxycarbonyl-5-oxo-7-propan-2-ylchromeno[2,3-b]pyridin-2-yl)acetic acid (CID 70513059) is 2-(3-methoxycarbonyl-5-oxo-7-propan-2-ylchromeno[2,3-b]pyridin-2-yl)acetic acid.
What is the SMILES notation for 2-(3-methoxycarbonyl-5-oxo-7-propan-2-ylchromeno[2,3-b]pyridin-2-yl)acetic acid?
The canonical SMILES for 2-(3-methoxycarbonyl-5-oxo-7-propan-2-ylchromeno[2,3-b]pyridin-2-yl)acetic acid is COC(=O)c1cc2c(=O)c3cc(C(C)C)ccc3oc2nc1CC(=O)O.
What is the InChIKey of 2-(3-methoxycarbonyl-5-oxo-7-propan-2-ylchromeno[2,3-b]pyridin-2-yl)acetic acid?
The InChIKey is KEDQQRXVOCIBAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO6/c1-9(2)10-4-5-15-12(6-10)17(23)13-7-11(19(24)25-3)14(8-16(21)22)20-18(13)26-15/h4-7,9H,8H2,1-3H3,(H,21,22).
What are the key properties of 2-(3-methoxycarbonyl-5-oxo-7-propan-2-ylchromeno[2,3-b]pyridin-2-yl)acetic acid?
2-(3-methoxycarbonyl-5-oxo-7-propan-2-ylchromeno[2,3-b]pyridin-2-yl)acetic acid has a molecular weight of 355.35 g/mol, XLogP of 2.88, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methoxycarbonyl-5-oxo-7-propan-2-ylchromeno[2,3-b]pyridin-2-yl)acetic acid is sourced from PubChem (CID 70513059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).