C22H19N3O4 — CID 164670563
2-(benzylamino)-3-nitro-7-propan-2-ylchromeno[2,3-b]pyridin-5-one (PubChem CID 164670563) has the molecular formula C22H19N3O4 and a molecular weight of 389.41 g/mol. Its IUPAC name is 2-(benzylamino)-3-nitro-7-propan-2-ylchromeno[2,3-b]pyridin-5-one.
| Compound Name | 2-(benzylamino)-3-nitro-7-propan-2-ylchromeno[2,3-b]pyridin-5-one |
|---|---|
| PubChem CID | 164670563 |
| Molecular Formula | C22H19N3O4 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 2-(benzylamino)-3-nitro-7-propan-2-ylchromeno[2,3-b]pyridin-5-one |
| SMILES | CC(C)c1ccc2oc3nc(NCc4ccccc4)c([N+](=O)[O-])cc3c(=O)c2c1 |
| InChI | InChI=1S/C22H19N3O4/c1-13(2)15-8-9-19-16(10-15)20(26)17-11-18(25(27)28)21(24-22(17)29-19)23-12-14-6-4-3-5-7-14/h3-11,13H,12H2,1-2H3,(H,23,24) |
| InChIKey | KLVKGRULWSZOJL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|