C17H11N3O5 — CID 164670550
2-(furan-2-ylmethylamino)-3-nitrochromeno[2,3-b]pyridin-5-one (PubChem CID 164670550) has the molecular formula C17H11N3O5 and a molecular weight of 337.29 g/mol. Its IUPAC name is 2-(furan-2-ylmethylamino)-3-nitrochromeno[2,3-b]pyridin-5-one.
| Compound Name | 2-(furan-2-ylmethylamino)-3-nitrochromeno[2,3-b]pyridin-5-one |
|---|---|
| PubChem CID | 164670550 |
| Molecular Formula | C17H11N3O5 |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 2-(furan-2-ylmethylamino)-3-nitrochromeno[2,3-b]pyridin-5-one |
| SMILES | O=c1c2ccccc2oc2nc(NCc3ccco3)c([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C17H11N3O5/c21-15-11-5-1-2-6-14(11)25-17-12(15)8-13(20(22)23)16(19-17)18-9-10-4-3-7-24-10/h1-8H,9H2,(H,18,19) |
| InChIKey | WPOJAYZHOBTTSB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 111.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|