C10H8BrN3O3 — CID 24903357
4-bromo-N-(furan-2-ylmethyl)-3-nitropyridin-2-amine (PubChem CID 24903357) has the molecular formula C10H8BrN3O3 and a molecular weight of 298.10 g/mol. Its IUPAC name is 4-bromo-N-(furan-2-ylmethyl)-3-nitropyridin-2-amine.
| Compound Name | 4-bromo-N-(furan-2-ylmethyl)-3-nitropyridin-2-amine |
|---|---|
| PubChem CID | 24903357 |
| Molecular Formula | C10H8BrN3O3 |
| Molecular Weight | 298.10 g/mol |
| Exact Mass | 296.97 |
| IUPAC Name | 4-bromo-N-(furan-2-ylmethyl)-3-nitropyridin-2-amine |
| SMILES | O=[N+]([O-])c1c(Br)ccnc1NCc1ccco1 |
| InChI | InChI=1S/C10H8BrN3O3/c11-8-3-4-12-10(9(8)14(15)16)13-6-7-2-1-5-17-7/h1-5H,6H2,(H,12,13) |
| InChIKey | CSOGRXWVGORIGK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.10 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|