C17H17N5O3 — CID 23484847
4-N-(3,4-dimethylphenyl)-6-N-(furan-2-ylmethyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 23484847) has the molecular formula C17H17N5O3 and a molecular weight of 339.36 g/mol. Its IUPAC name is 4-N-(3,4-dimethylphenyl)-6-N-(furan-2-ylmethyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-(3,4-dimethylphenyl)-6-N-(furan-2-ylmethyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23484847 |
| Molecular Formula | C17H17N5O3 |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 4-N-(3,4-dimethylphenyl)-6-N-(furan-2-ylmethyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | Cc1ccc(Nc2ncnc(NCc3ccco3)c2[N+](=O)[O-])cc1C |
| InChI | InChI=1S/C17H17N5O3/c1-11-5-6-13(8-12(11)2)21-17-15(22(23)24)16(19-10-20-17)18-9-14-4-3-7-25-14/h3-8,10H,9H2,1-2H3,(H2,18,19,20,21) |
| InChIKey | QEBZOLXHRQNIAU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|