C17H17N3O4 — CID 164670561
2-(ethylamino)-3-nitro-7-propan-2-ylchromeno[2,3-b]pyridin-5-one (PubChem CID 164670561) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is 2-(ethylamino)-3-nitro-7-propan-2-ylchromeno[2,3-b]pyridin-5-one.
| Compound Name | 2-(ethylamino)-3-nitro-7-propan-2-ylchromeno[2,3-b]pyridin-5-one |
|---|---|
| PubChem CID | 164670561 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 2-(ethylamino)-3-nitro-7-propan-2-ylchromeno[2,3-b]pyridin-5-one |
| SMILES | CCNc1nc2oc3ccc(C(C)C)cc3c(=O)c2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17N3O4/c1-4-18-16-13(20(22)23)8-12-15(21)11-7-10(9(2)3)5-6-14(11)24-17(12)19-16/h5-9H,4H2,1-3H3,(H,18,19) |
| InChIKey | UZNJDQDCGUSVLZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|