C13H15N3O2 — CID 174878074
N,6-diethyl-3-nitroquinolin-2-amine (PubChem CID 174878074) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is N,6-diethyl-3-nitroquinolin-2-amine.
| Compound Name | N,6-diethyl-3-nitroquinolin-2-amine |
|---|---|
| PubChem CID | 174878074 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | N,6-diethyl-3-nitroquinolin-2-amine |
| SMILES | CCNc1nc2ccc(CC)cc2cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15N3O2/c1-3-9-5-6-11-10(7-9)8-12(16(17)18)13(15-11)14-4-2/h5-8H,3-4H2,1-2H3,(H,14,15) |
| InChIKey | CWZUAFWIPDVYSU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|