About 3-ethyl-8-nitroquinoline
3-ethyl-8-nitroquinoline (PubChem CID 119082070) has the molecular formula C11H10N2O2
and a molecular weight of 202.21 g/mol. Its IUPAC name is 3-ethyl-8-nitroquinoline.
Molecular Properties
| Compound Name | 3-ethyl-8-nitroquinoline |
| PubChem CID | 119082070 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 3-ethyl-8-nitroquinoline |
| SMILES | CCc1cnc2c([N+](=O)[O-])cccc2c1 |
| InChI | InChI=1S/C11H10N2O2/c1-2-8-6-9-4-3-5-10(13(14)15)11(9)12-7-8/h3-7H,2H2,1H3 |
| InChIKey | RDSQLSCYBZYWAW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-8-nitroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-8-nitroquinoline?
The IUPAC name of 3-ethyl-8-nitroquinoline (CID 119082070) is 3-ethyl-8-nitroquinoline.
What is the SMILES notation for 3-ethyl-8-nitroquinoline?
The canonical SMILES for 3-ethyl-8-nitroquinoline is CCc1cnc2c([N+](=O)[O-])cccc2c1.
What is the InChIKey of 3-ethyl-8-nitroquinoline?
The InChIKey is RDSQLSCYBZYWAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2/c1-2-8-6-9-4-3-5-10(13(14)15)11(9)12-7-8/h3-7H,2H2,1H3.
What are the key properties of 3-ethyl-8-nitroquinoline?
3-ethyl-8-nitroquinoline has a molecular weight of 202.21 g/mol, XLogP of 2.71, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-8-nitroquinoline is sourced from PubChem (CID 119082070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).